C14H9FN2O3 — CID 117261137
5-fluoro-3-(4-hydroxyphenyl)-1H-quinazoline-2,4-dione (PubChem CID 117261137) has the molecular formula C14H9FN2O3 and a molecular weight of 272.24 g/mol. Its IUPAC name is 5-fluoro-3-(4-hydroxyphenyl)-1H-quinazoline-2,4-dione.
| Compound Name | 5-fluoro-3-(4-hydroxyphenyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261137 |
| Molecular Formula | C14H9FN2O3 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 5-fluoro-3-(4-hydroxyphenyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2cccc(F)c2c(=O)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C14H9FN2O3/c15-10-2-1-3-11-12(10)13(19)17(14(20)16-11)8-4-6-9(18)7-5-8/h1-7,18H,(H,16,20) |
| InChIKey | NXYLMNLMHFKNKR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |