C9H14F2O3 — CID 115025684
4,4-difluoro-3-(oxan-4-yl)butanoic acid (PubChem CID 115025684) has the molecular formula C9H14F2O3 and a molecular weight of 208.20 g/mol. Its IUPAC name is 4,4-difluoro-3-(oxan-4-yl)butanoic acid.
| Compound Name | 4,4-difluoro-3-(oxan-4-yl)butanoic acid |
|---|---|
| PubChem CID | 115025684 |
| Molecular Formula | C9H14F2O3 |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4,4-difluoro-3-(oxan-4-yl)butanoic acid |
| SMILES | O=C(O)CC(C(F)F)C1CCOCC1 |
| InChI | InChI=1S/C9H14F2O3/c10-9(11)7(5-8(12)13)6-1-3-14-4-2-6/h6-7,9H,1-5H2,(H,12,13) |
| InChIKey | FNSOLRMYUCJSSI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |