C16H23ClO3 — CID 144917380
3-(4-chlorophenyl)-3-(oxan-4-yl)propanoic acid;ethane (PubChem CID 144917380) has the molecular formula C16H23ClO3 and a molecular weight of 298.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-(oxan-4-yl)propanoic acid;ethane.
| Compound Name | 3-(4-chlorophenyl)-3-(oxan-4-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 144917380 |
| Molecular Formula | C16H23ClO3 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(4-chlorophenyl)-3-(oxan-4-yl)propanoic acid;ethane |
| SMILES | CC.O=C(O)CC(c1ccc(Cl)cc1)C1CCOCC1 |
| InChI | InChI=1S/C14H17ClO3.C2H6/c15-12-3-1-10(2-4-12)13(9-14(16)17)11-5-7-18-8-6-11;1-2/h1-4,11,13H,5-9H2,(H,16,17);1-2H3 |
| InChIKey | CGKPZKJQYBDQIK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |