C9H17F2NS — CID 115026572
4,4-difluoro-3-(thian-3-yl)butan-1-amine (PubChem CID 115026572) has the molecular formula C9H17F2NS and a molecular weight of 209.30 g/mol. Its IUPAC name is 4,4-difluoro-3-(thian-3-yl)butan-1-amine.
| Compound Name | 4,4-difluoro-3-(thian-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 115026572 |
| Molecular Formula | C9H17F2NS |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4,4-difluoro-3-(thian-3-yl)butan-1-amine |
| SMILES | NCCC(C(F)F)C1CCCSC1 |
| InChI | InChI=1S/C9H17F2NS/c10-9(11)8(3-4-12)7-2-1-5-13-6-7/h7-9H,1-6,12H2 |
| InChIKey | PWWYCRJYLMVQGR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |