C10H16ClN3 — CID 115028562
2-chloro-5-ethyl-4-(1-methylpyrrolidin-2-yl)-1H-imidazole (PubChem CID 115028562) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is 2-chloro-5-ethyl-4-(1-methylpyrrolidin-2-yl)-1H-imidazole.
| Compound Name | 2-chloro-5-ethyl-4-(1-methylpyrrolidin-2-yl)-1H-imidazole |
|---|---|
| PubChem CID | 115028562 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-chloro-5-ethyl-4-(1-methylpyrrolidin-2-yl)-1H-imidazole |
| SMILES | CCc1[nH]c(Cl)nc1C1CCCN1C |
| InChI | InChI=1S/C10H16ClN3/c1-3-7-9(13-10(11)12-7)8-5-4-6-14(8)2/h8H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | UEOBKKVISIWHFX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |