C11H7FN4 — CID 115028622
2-(2-fluoroanilino)pyrimidine-5-carbonitrile (PubChem CID 115028622) has the molecular formula C11H7FN4 and a molecular weight of 214.20 g/mol. Its IUPAC name is 2-(2-fluoroanilino)pyrimidine-5-carbonitrile.
| Compound Name | 2-(2-fluoroanilino)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 115028622 |
| Molecular Formula | C11H7FN4 |
| Molecular Weight | 214.20 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-(2-fluoroanilino)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(Nc2ccccc2F)nc1 |
| InChI | InChI=1S/C11H7FN4/c12-9-3-1-2-4-10(9)16-11-14-6-8(5-13)7-15-11/h1-4,6-7H,(H,14,15,16) |
| InChIKey | YTDKOODXZLDTAY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |