C13H11FN4 — CID 103468059
5-amino-6-(3-fluoro-2-methylanilino)pyridine-3-carbonitrile (PubChem CID 103468059) has the molecular formula C13H11FN4 and a molecular weight of 242.26 g/mol. Its IUPAC name is 5-amino-6-(3-fluoro-2-methylanilino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-(3-fluoro-2-methylanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103468059 |
| Molecular Formula | C13H11FN4 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 5-amino-6-(3-fluoro-2-methylanilino)pyridine-3-carbonitrile |
| SMILES | Cc1c(F)cccc1Nc1ncc(C#N)cc1N |
| InChI | InChI=1S/C13H11FN4/c1-8-10(14)3-2-4-12(8)18-13-11(16)5-9(6-15)7-17-13/h2-5,7H,16H2,1H3,(H,17,18) |
| InChIKey | AYXQJEUZFQIWJA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |