C10H18N2O3 — CID 115028740
3-hydroxy-1-piperidin-4-ylpyrrolidine-3-carboxylic acid (PubChem CID 115028740) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-hydroxy-1-piperidin-4-ylpyrrolidine-3-carboxylic acid.
| Compound Name | 3-hydroxy-1-piperidin-4-ylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115028740 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 3-hydroxy-1-piperidin-4-ylpyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1(O)CCN(C2CCNCC2)C1 |
| InChI | InChI=1S/C10H18N2O3/c13-9(14)10(15)3-6-12(7-10)8-1-4-11-5-2-8/h8,11,15H,1-7H2,(H,13,14) |
| InChIKey | UWJSZRLNDJUSOJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |