C13H16N2O — CID 115029633
3-(2-aminoethyl)-1,7-dimethylquinolin-2-one (PubChem CID 115029633) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1,7-dimethylquinolin-2-one.
| Compound Name | 3-(2-aminoethyl)-1,7-dimethylquinolin-2-one |
|---|---|
| PubChem CID | 115029633 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-(2-aminoethyl)-1,7-dimethylquinolin-2-one |
| SMILES | Cc1ccc2cc(CCN)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C13H16N2O/c1-9-3-4-10-8-11(5-6-14)13(16)15(2)12(10)7-9/h3-4,7-8H,5-6,14H2,1-2H3 |
| InChIKey | NCXINNUKOISRNR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |