C7H11F5N2 — CID 115030408
1-(2,2,3,3,3-pentafluoropropyl)pyrrolidin-3-amine (PubChem CID 115030408) has the molecular formula C7H11F5N2 and a molecular weight of 218.17 g/mol. Its IUPAC name is 1-(2,2,3,3,3-pentafluoropropyl)pyrrolidin-3-amine.
| Compound Name | 1-(2,2,3,3,3-pentafluoropropyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115030408 |
| Molecular Formula | C7H11F5N2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-(2,2,3,3,3-pentafluoropropyl)pyrrolidin-3-amine |
| SMILES | NC1CCN(CC(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H11F5N2/c8-6(9,7(10,11)12)4-14-2-1-5(13)3-14/h5H,1-4,13H2 |
| InChIKey | CTZRUGBUQLBEJL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|