C11H18F5N — CID 137409417
1-(2,2,3,3,3-pentafluoropropyl)-4-propan-2-ylpiperidine (PubChem CID 137409417) has the molecular formula C11H18F5N and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-(2,2,3,3,3-pentafluoropropyl)-4-propan-2-ylpiperidine.
| Compound Name | 1-(2,2,3,3,3-pentafluoropropyl)-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 137409417 |
| Molecular Formula | C11H18F5N |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(2,2,3,3,3-pentafluoropropyl)-4-propan-2-ylpiperidine |
| SMILES | CC(C)C1CCN(CC(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F5N/c1-8(2)9-3-5-17(6-4-9)7-10(12,13)11(14,15)16/h8-9H,3-7H2,1-2H3 |
| InChIKey | HBLROFUGGLYKAC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|