C11H21F2NO — CID 174183157
2,2-difluoro-3-(4-propan-2-ylpiperidin-1-yl)propan-1-ol (PubChem CID 174183157) has the molecular formula C11H21F2NO and a molecular weight of 221.29 g/mol. Its IUPAC name is 2,2-difluoro-3-(4-propan-2-ylpiperidin-1-yl)propan-1-ol.
| Compound Name | 2,2-difluoro-3-(4-propan-2-ylpiperidin-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 174183157 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2,2-difluoro-3-(4-propan-2-ylpiperidin-1-yl)propan-1-ol |
| SMILES | CC(C)C1CCN(CC(F)(F)CO)CC1 |
| InChI | InChI=1S/C11H21F2NO/c1-9(2)10-3-5-14(6-4-10)7-11(12,13)8-15/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | QLRAQFQKSAPNBL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |