C13H27F2NO — CID 176693193
1-(2,2-difluoropropyl)-4-propan-2-yloxypiperidine;ethane (PubChem CID 176693193) has the molecular formula C13H27F2NO and a molecular weight of 251.36 g/mol. Its IUPAC name is 1-(2,2-difluoropropyl)-4-propan-2-yloxypiperidine;ethane.
| Compound Name | 1-(2,2-difluoropropyl)-4-propan-2-yloxypiperidine;ethane |
|---|---|
| PubChem CID | 176693193 |
| Molecular Formula | C13H27F2NO |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 1-(2,2-difluoropropyl)-4-propan-2-yloxypiperidine;ethane |
| SMILES | CC.CC(C)OC1CCN(CC(C)(F)F)CC1 |
| InChI | InChI=1S/C11H21F2NO.C2H6/c1-9(2)15-10-4-6-14(7-5-10)8-11(3,12)13;1-2/h9-10H,4-8H2,1-3H3;1-2H3 |
| InChIKey | GBXTYBBMXFYRSI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |