C18H34F2N2OS — CID 175636119
(1S)-1-[4-[2,2-difluoro-3-(4-propan-2-ylpiperazin-1-yl)propyl]cyclohexyl]oxyethanethiol (PubChem CID 175636119) has the molecular formula C18H34F2N2OS and a molecular weight of 364.55 g/mol. Its IUPAC name is (1S)-1-[4-[2,2-difluoro-3-(4-propan-2-ylpiperazin-1-yl)propyl]cyclohexyl]oxyethanethiol.
| Compound Name | (1S)-1-[4-[2,2-difluoro-3-(4-propan-2-ylpiperazin-1-yl)propyl]cyclohexyl]oxyethanethiol |
|---|---|
| PubChem CID | 175636119 |
| Molecular Formula | C18H34F2N2OS |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (1S)-1-[4-[2,2-difluoro-3-(4-propan-2-ylpiperazin-1-yl)propyl]cyclohexyl]oxyethanethiol |
| SMILES | CC(C)N1CCN(CC(F)(F)CC2CCC(O[C@H](C)S)CC2)CC1 |
| InChI | InChI=1S/C18H34F2N2OS/c1-14(2)22-10-8-21(9-11-22)13-18(19,20)12-16-4-6-17(7-5-16)23-15(3)24/h14-17,24H,4-13H2,1-3H3/t15-,16?,17?/m0/s1 |
| InChIKey | NRCFVNBBFGUTFE-GTPINHCMSA-N |
| XLogP | 3.89 |
| TPSA | 15.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|