C19H38N2O — CID 175636192
1-[(3R)-4-(4-methoxycyclohexyl)-3-methylbutyl]-4-propan-2-ylpiperazine (PubChem CID 175636192) has the molecular formula C19H38N2O and a molecular weight of 310.53 g/mol. Its IUPAC name is 1-[(3R)-4-(4-methoxycyclohexyl)-3-methylbutyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[(3R)-4-(4-methoxycyclohexyl)-3-methylbutyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 175636192 |
| Molecular Formula | C19H38N2O |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | 1-[(3R)-4-(4-methoxycyclohexyl)-3-methylbutyl]-4-propan-2-ylpiperazine |
| SMILES | COC1CCC(C[C@@H](C)CCN2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C19H38N2O/c1-16(2)21-13-11-20(12-14-21)10-9-17(3)15-18-5-7-19(22-4)8-6-18/h16-19H,5-15H2,1-4H3/t17-,18?,19?/m0/s1 |
| InChIKey | FRTIMJCAAJZWDI-VIQWUECVSA-N |
| XLogP | 3.63 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |