C30H61N3O2 — CID 176986204
4-(4-ethylcyclohexyl)oxy-1-propan-2-ylpiperidine;1-[2-(3-methylbutoxy)ethyl]-4-propan-2-ylpiperazine (PubChem CID 176986204) has the molecular formula C30H61N3O2 and a molecular weight of 495.84 g/mol. Its IUPAC name is 4-(4-ethylcyclohexyl)oxy-1-propan-2-ylpiperidine;1-[2-(3-methylbutoxy)ethyl]-4-propan-2-ylpiperazine.
| Compound Name | 4-(4-ethylcyclohexyl)oxy-1-propan-2-ylpiperidine;1-[2-(3-methylbutoxy)ethyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 176986204 |
| Molecular Formula | C30H61N3O2 |
| Molecular Weight | 495.84 g/mol |
| Exact Mass | 495.48 |
| IUPAC Name | 4-(4-ethylcyclohexyl)oxy-1-propan-2-ylpiperidine;1-[2-(3-methylbutoxy)ethyl]-4-propan-2-ylpiperazine |
| SMILES | CC(C)CCOCCN1CCN(C(C)C)CC1.CCC1CCC(OC2CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C16H31NO.C14H30N2O/c1-4-14-5-7-15(8-6-14)18-16-9-11-17(12-10-16)13(2)3;1-13(2)5-11-17-12-10-15-6-8-16(9-7-15)14(3)4/h13-16H,4-12H2,1-3H3;13-14H,5-12H2,1-4H3 |
| InChIKey | HMTJUDFUIKLPLM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 28.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.84 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|