About 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid
2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid (PubChem CID 115031136) has the molecular formula C10H9N3O3
and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid |
| PubChem CID | 115031136 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1ncn(-c2ccccc2O)n1 |
| InChI | InChI=1S/C10H9N3O3/c14-8-4-2-1-3-7(8)13-6-11-9(12-13)5-10(15)16/h1-4,6,14H,5H2,(H,15,16) |
| InChIKey | UNHAEGBGEBMBOA-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid?
The IUPAC name of 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid (CID 115031136) is 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid.
What is the SMILES notation for 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid?
The canonical SMILES for 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid is O=C(O)Cc1ncn(-c2ccccc2O)n1.
What is the InChIKey of 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid?
The InChIKey is UNHAEGBGEBMBOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c14-8-4-2-1-3-7(8)13-6-11-9(12-13)5-10(15)16/h1-4,6,14H,5H2,(H,15,16).
What are the key properties of 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid?
2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid has a molecular weight of 219.20 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-hydroxyphenyl)-1,2,4-triazol-3-yl]acetic acid is sourced from PubChem (CID 115031136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).