C13H14N2O2 — CID 115037686
4-(2-cyclobutyl-1H-imidazol-5-yl)benzene-1,2-diol (PubChem CID 115037686) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-(2-cyclobutyl-1H-imidazol-5-yl)benzene-1,2-diol.
| Compound Name | 4-(2-cyclobutyl-1H-imidazol-5-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 115037686 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-(2-cyclobutyl-1H-imidazol-5-yl)benzene-1,2-diol |
| SMILES | Oc1ccc(-c2cnc(C3CCC3)[nH]2)cc1O |
| InChI | InChI=1S/C13H14N2O2/c16-11-5-4-9(6-12(11)17)10-7-14-13(15-10)8-2-1-3-8/h4-8,16-17H,1-3H2,(H,14,15) |
| InChIKey | JWFONRSTNHQLCF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|