C10H7F3N2O2 — CID 115045191
4-[2-(trifluoromethyl)-1H-imidazol-5-yl]benzene-1,2-diol (PubChem CID 115045191) has the molecular formula C10H7F3N2O2 and a molecular weight of 244.17 g/mol. Its IUPAC name is 4-[2-(trifluoromethyl)-1H-imidazol-5-yl]benzene-1,2-diol.
| Compound Name | 4-[2-(trifluoromethyl)-1H-imidazol-5-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 115045191 |
| Molecular Formula | C10H7F3N2O2 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 4-[2-(trifluoromethyl)-1H-imidazol-5-yl]benzene-1,2-diol |
| SMILES | Oc1ccc(-c2cnc(C(F)(F)F)[nH]2)cc1O |
| InChI | InChI=1S/C10H7F3N2O2/c11-10(12,13)9-14-4-6(15-9)5-1-2-7(16)8(17)3-5/h1-4,16-17H,(H,14,15) |
| InChIKey | OWTMGSNPGWIMAB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|