About 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol
4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol (PubChem CID 115037705) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol.
Molecular Properties
| Compound Name | 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol |
| PubChem CID | 115037705 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol |
| SMILES | Oc1ccc(-c2cnc(CC3CNC3)o2)cc1 |
| InChI | InChI=1S/C13H14N2O2/c16-11-3-1-10(2-4-11)12-8-15-13(17-12)5-9-6-14-7-9/h1-4,8-9,14,16H,5-7H2 |
| InChIKey | HGUUHODTTAJRDD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol?
The IUPAC name of 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol (CID 115037705) is 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol.
What is the SMILES notation for 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol?
The canonical SMILES for 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol is Oc1ccc(-c2cnc(CC3CNC3)o2)cc1.
What is the InChIKey of 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol?
The InChIKey is HGUUHODTTAJRDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c16-11-3-1-10(2-4-11)12-8-15-13(17-12)5-9-6-14-7-9/h1-4,8-9,14,16H,5-7H2.
What are the key properties of 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol?
4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol has a molecular weight of 230.27 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(azetidin-3-ylmethyl)-1,3-oxazol-5-yl]phenol is sourced from PubChem (CID 115037705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).