C10H15ClN2O2 — CID 115038025
3-[5-chloro-1-(2-methylpropyl)pyrazol-4-yl]propanoic acid (PubChem CID 115038025) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is 3-[5-chloro-1-(2-methylpropyl)pyrazol-4-yl]propanoic acid.
| Compound Name | 3-[5-chloro-1-(2-methylpropyl)pyrazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 115038025 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-[5-chloro-1-(2-methylpropyl)pyrazol-4-yl]propanoic acid |
| SMILES | CC(C)Cn1ncc(CCC(=O)O)c1Cl |
| InChI | InChI=1S/C10H15ClN2O2/c1-7(2)6-13-10(11)8(5-12-13)3-4-9(14)15/h5,7H,3-4,6H2,1-2H3,(H,14,15) |
| InChIKey | GIKHHYSHIRRMTN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |