C12H12FN3O — CID 115039378
6-fluoro-2-pyrrolidin-3-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 115039378) has the molecular formula C12H12FN3O and a molecular weight of 233.25 g/mol. Its IUPAC name is 6-fluoro-2-pyrrolidin-3-ylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 6-fluoro-2-pyrrolidin-3-ylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115039378 |
| Molecular Formula | C12H12FN3O |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 6-fluoro-2-pyrrolidin-3-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(C2CCNC2)nc2cccc(F)n12 |
| InChI | InChI=1S/C12H12FN3O/c13-10-2-1-3-11-15-9(6-12(17)16(10)11)8-4-5-14-7-8/h1-3,6,8,14H,4-5,7H2 |
| InChIKey | IAMRGBZZLSCKJL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|