C10H10FN3O — CID 115025028
2-(2-aminoethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one (PubChem CID 115025028) has the molecular formula C10H10FN3O and a molecular weight of 207.21 g/mol. Its IUPAC name is 2-(2-aminoethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(2-aminoethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115025028 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 2-(2-aminoethyl)-7-fluoropyrido[1,2-a]pyrimidin-4-one |
| SMILES | NCCc1cc(=O)n2cc(F)ccc2n1 |
| InChI | InChI=1S/C10H10FN3O/c11-7-1-2-9-13-8(3-4-12)5-10(15)14(9)6-7/h1-2,5-6H,3-4,12H2 |
| InChIKey | MPEYGIXYOJXTEG-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |