About 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one
7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one (PubChem CID 138958353) has the molecular formula C10H9F2N3O
and a molecular weight of 225.20 g/mol. Its IUPAC name is 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 138958353 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCc1nc2c(F)cc(N)cn2c(=O)c1F |
| InChI | InChI=1S/C10H9F2N3O/c1-2-7-8(12)10(16)15-4-5(13)3-6(11)9(15)14-7/h3-4H,2,13H2,1H3 |
| InChIKey | PTUMHEGDYGUHDM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one (CID 138958353) is 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one is CCc1nc2c(F)cc(N)cn2c(=O)c1F.
What is the InChIKey of 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one?
The InChIKey is PTUMHEGDYGUHDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2N3O/c1-2-7-8(12)10(16)15-4-5(13)3-6(11)9(15)14-7/h3-4H,2,13H2,1H3.
What are the key properties of 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one?
7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one has a molecular weight of 225.20 g/mol, XLogP of 1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-ethyl-3,9-difluoropyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 138958353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).