3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride

C9H10F2O3S — CID 115041325

IUPAC3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride
SMILESO=S(=O)(F)CC(O)Cc1ccc(F)cc1
InChIInChI=1S/C9H10F2O3S/c10-8-3-1-7(2-4-8)5-9(12)6-15(11,13)14/h1-4,9,12H,5-6H2
InChIKeyREPCEWJIDQMLBN-UHFFFAOYSA-N
MW236.24 g/mol
LogP1.03
Rot. Bonds4

About 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride

3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride (PubChem CID 115041325) has the molecular formula C9H10F2O3S and a molecular weight of 236.24 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride.

Molecular Properties

Compound Name3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride
PubChem CID115041325
Molecular FormulaC9H10F2O3S
Molecular Weight236.24 g/mol
Exact Mass236.03
IUPAC Name3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride
SMILESO=S(=O)(F)CC(O)Cc1ccc(F)cc1
InChIInChI=1S/C9H10F2O3S/c10-8-3-1-7(2-4-8)5-9(12)6-15(11,13)14/h1-4,9,12H,5-6H2
InChIKeyREPCEWJIDQMLBN-UHFFFAOYSA-N
XLogP1.03
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.24
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride?
The IUPAC name of 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride (CID 115041325) is 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride.
What is the SMILES notation for 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride?
The canonical SMILES for 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride is O=S(=O)(F)CC(O)Cc1ccc(F)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride?
The InChIKey is REPCEWJIDQMLBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2O3S/c10-8-3-1-7(2-4-8)5-9(12)6-15(11,13)14/h1-4,9,12H,5-6H2.
What are the key properties of 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride?
3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride has a molecular weight of 236.24 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-2-hydroxypropane-1-sulfonyl fluoride is sourced from PubChem (CID 115041325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).