C12H19N3S — CID 115042260
2-(azetidin-3-yl)-5-methyl-4-piperidin-2-yl-1,3-thiazole (PubChem CID 115042260) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-5-methyl-4-piperidin-2-yl-1,3-thiazole.
| Compound Name | 2-(azetidin-3-yl)-5-methyl-4-piperidin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 115042260 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 2-(azetidin-3-yl)-5-methyl-4-piperidin-2-yl-1,3-thiazole |
| SMILES | Cc1sc(C2CNC2)nc1C1CCCCN1 |
| InChI | InChI=1S/C12H19N3S/c1-8-11(10-4-2-3-5-14-10)15-12(16-8)9-6-13-7-9/h9-10,13-14H,2-7H2,1H3 |
| InChIKey | BSRYVYQBZUCFAS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |