C9H13BrN2S — CID 115048783
2-bromo-5-methyl-4-piperidin-3-yl-1,3-thiazole (PubChem CID 115048783) has the molecular formula C9H13BrN2S and a molecular weight of 261.19 g/mol. Its IUPAC name is 2-bromo-5-methyl-4-piperidin-3-yl-1,3-thiazole.
| Compound Name | 2-bromo-5-methyl-4-piperidin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 115048783 |
| Molecular Formula | C9H13BrN2S |
| Molecular Weight | 261.19 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-bromo-5-methyl-4-piperidin-3-yl-1,3-thiazole |
| SMILES | Cc1sc(Br)nc1C1CCCNC1 |
| InChI | InChI=1S/C9H13BrN2S/c1-6-8(12-9(10)13-6)7-3-2-4-11-5-7/h7,11H,2-5H2,1H3 |
| InChIKey | PRYIMINPGLYXEY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |