C13H20N2S — CID 116885135
2-cyclobutyl-4-methyl-5-piperidin-3-yl-1,3-thiazole (PubChem CID 116885135) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is 2-cyclobutyl-4-methyl-5-piperidin-3-yl-1,3-thiazole.
| Compound Name | 2-cyclobutyl-4-methyl-5-piperidin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 116885135 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-cyclobutyl-4-methyl-5-piperidin-3-yl-1,3-thiazole |
| SMILES | Cc1nc(C2CCC2)sc1C1CCCNC1 |
| InChI | InChI=1S/C13H20N2S/c1-9-12(11-6-3-7-14-8-11)16-13(15-9)10-4-2-5-10/h10-11,14H,2-8H2,1H3 |
| InChIKey | BNDDREVTKYCRFU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |