C15H14N2O — CID 115042593
2-(3,4-dihydro-2H-quinolin-1-yl)pyridine-4-carbaldehyde (PubChem CID 115042593) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)pyridine-4-carbaldehyde.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 115042593 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)pyridine-4-carbaldehyde |
| SMILES | O=Cc1ccnc(N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C15H14N2O/c18-11-12-7-8-16-15(10-12)17-9-3-5-13-4-1-2-6-14(13)17/h1-2,4,6-8,10-11H,3,5,9H2 |
| InChIKey | XVVKZVSXLXJWIL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|