C24H18F3N5O5 — CID 11504470
(E)-3-(4,5-dimethoxy-2-nitrophenyl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one (PubChem CID 11504470) has the molecular formula C24H18F3N5O5 and a molecular weight of 513.43 g/mol. Its IUPAC name is (E)-3-(4,5-dimethoxy-2-nitrophenyl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(4,5-dimethoxy-2-nitrophenyl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 11504470 |
| Molecular Formula | C24H18F3N5O5 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (E)-3-(4,5-dimethoxy-2-nitrophenyl)-1-[5-methyl-1-[8-(trifluoromethyl)quinolin-4-yl]triazol-4-yl]prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2nnn(-c3ccnc4c(C(F)(F)F)cccc34)c2C)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C24H18F3N5O5/c1-13-22(19(33)8-7-14-11-20(36-2)21(37-3)12-18(14)32(34)35)29-30-31(13)17-9-10-28-23-15(17)5-4-6-16(23)24(25,26)27/h4-12H,1-3H3/b8-7+ |
| InChIKey | WHOSLFDAAPGPGL-BQYQJAHWSA-N |
| XLogP | 4.96 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|