About 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol
4-(3-amino-2,2-dimethylpropyl)sulfonylphenol (PubChem CID 115045071) has the molecular formula C11H17NO3S
and a molecular weight of 243.33 g/mol. Its IUPAC name is 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol.
Molecular Properties
| Compound Name | 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol |
| PubChem CID | 115045071 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol |
| SMILES | CC(C)(CN)CS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H17NO3S/c1-11(2,7-12)8-16(14,15)10-5-3-9(13)4-6-10/h3-6,13H,7-8,12H2,1-2H3 |
| InChIKey | UTHOYIABUXGCEB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol?
The IUPAC name of 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol (CID 115045071) is 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol.
What is the SMILES notation for 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol?
The canonical SMILES for 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol is CC(C)(CN)CS(=O)(=O)c1ccc(O)cc1.
What is the InChIKey of 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol?
The InChIKey is UTHOYIABUXGCEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3S/c1-11(2,7-12)8-16(14,15)10-5-3-9(13)4-6-10/h3-6,13H,7-8,12H2,1-2H3.
What are the key properties of 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol?
4-(3-amino-2,2-dimethylpropyl)sulfonylphenol has a molecular weight of 243.33 g/mol, XLogP of 1.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-2,2-dimethylpropyl)sulfonylphenol is sourced from PubChem (CID 115045071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).