C12H14ClF2N — CID 115045643
2-(2-chlorophenyl)-4,4-difluoro-2-methylpiperidine (PubChem CID 115045643) has the molecular formula C12H14ClF2N and a molecular weight of 245.70 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4,4-difluoro-2-methylpiperidine.
| Compound Name | 2-(2-chlorophenyl)-4,4-difluoro-2-methylpiperidine |
|---|---|
| PubChem CID | 115045643 |
| Molecular Formula | C12H14ClF2N |
| Molecular Weight | 245.70 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2-(2-chlorophenyl)-4,4-difluoro-2-methylpiperidine |
| SMILES | CC1(c2ccccc2Cl)CC(F)(F)CCN1 |
| InChI | InChI=1S/C12H14ClF2N/c1-11(8-12(14,15)6-7-16-11)9-4-2-3-5-10(9)13/h2-5,16H,6-8H2,1H3 |
| InChIKey | RJOTUBREONJKLT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.70 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |