C10H18O5S — CID 115046716
tert-butyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate (PubChem CID 115046716) has the molecular formula C10H18O5S and a molecular weight of 250.32 g/mol. Its IUPAC name is tert-butyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate.
| Compound Name | tert-butyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate |
|---|---|
| PubChem CID | 115046716 |
| Molecular Formula | C10H18O5S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | tert-butyl 2-(3-hydroxy-1,1-dioxothiolan-3-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CC1(O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18O5S/c1-9(2,3)15-8(11)6-10(12)4-5-16(13,14)7-10/h12H,4-7H2,1-3H3 |
| InChIKey | TUNZOGOESYBNMD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |