C10H19FN2O2S — CID 115046718
1-(1,1-dioxothian-4-yl)-3-(fluoromethyl)pyrrolidin-3-amine (PubChem CID 115046718) has the molecular formula C10H19FN2O2S and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-3-(fluoromethyl)pyrrolidin-3-amine.
| Compound Name | 1-(1,1-dioxothian-4-yl)-3-(fluoromethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 115046718 |
| Molecular Formula | C10H19FN2O2S |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-3-(fluoromethyl)pyrrolidin-3-amine |
| SMILES | NC1(CF)CCN(C2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C10H19FN2O2S/c11-7-10(12)3-4-13(8-10)9-1-5-16(14,15)6-2-9/h9H,1-8,12H2 |
| InChIKey | VCCQSWANUMWLOL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |