C11H6BrFN2 — CID 115049280
2-bromo-10-fluoroimidazo[2,1-a]isoquinoline (PubChem CID 115049280) has the molecular formula C11H6BrFN2 and a molecular weight of 265.09 g/mol. Its IUPAC name is 2-bromo-10-fluoroimidazo[2,1-a]isoquinoline.
| Compound Name | 2-bromo-10-fluoroimidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 115049280 |
| Molecular Formula | C11H6BrFN2 |
| Molecular Weight | 265.09 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-bromo-10-fluoroimidazo[2,1-a]isoquinoline |
| SMILES | Fc1cccc2ccn3cc(Br)nc3c12 |
| InChI | InChI=1S/C11H6BrFN2/c12-9-6-15-5-4-7-2-1-3-8(13)10(7)11(15)14-9/h1-6H |
| InChIKey | ITHQMMRTHPHOHD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.09 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |