C17H11FN2 — CID 138975222
2-(2-fluorophenyl)imidazo[2,1-a]isoquinoline (PubChem CID 138975222) has the molecular formula C17H11FN2 and a molecular weight of 262.29 g/mol. Its IUPAC name is 2-(2-fluorophenyl)imidazo[2,1-a]isoquinoline.
| Compound Name | 2-(2-fluorophenyl)imidazo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 138975222 |
| Molecular Formula | C17H11FN2 |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-(2-fluorophenyl)imidazo[2,1-a]isoquinoline |
| SMILES | Fc1ccccc1-c1cn2ccc3ccccc3c2n1 |
| InChI | InChI=1S/C17H11FN2/c18-15-8-4-3-7-14(15)16-11-20-10-9-12-5-1-2-6-13(12)17(20)19-16/h1-11H |
| InChIKey | FKVZBIRKQQIBIJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |