C11H12BrN3 — CID 115049456
N-(3-bromophenyl)-1,5-dimethylpyrazol-4-amine (PubChem CID 115049456) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is N-(3-bromophenyl)-1,5-dimethylpyrazol-4-amine.
| Compound Name | N-(3-bromophenyl)-1,5-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 115049456 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | N-(3-bromophenyl)-1,5-dimethylpyrazol-4-amine |
| SMILES | Cc1c(Nc2cccc(Br)c2)cnn1C |
| InChI | InChI=1S/C11H12BrN3/c1-8-11(7-13-15(8)2)14-10-5-3-4-9(12)6-10/h3-7,14H,1-2H3 |
| InChIKey | VHJOIRNRKSXFBS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |