C14H27FN2O2 — CID 115050841
tert-butyl 4-(4-amino-1-fluorobutan-2-yl)piperidine-1-carboxylate (PubChem CID 115050841) has the molecular formula C14H27FN2O2 and a molecular weight of 274.38 g/mol. Its IUPAC name is tert-butyl 4-(4-amino-1-fluorobutan-2-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-amino-1-fluorobutan-2-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 115050841 |
| Molecular Formula | C14H27FN2O2 |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | tert-butyl 4-(4-amino-1-fluorobutan-2-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(CF)CCN)CC1 |
| InChI | InChI=1S/C14H27FN2O2/c1-14(2,3)19-13(18)17-8-5-11(6-9-17)12(10-15)4-7-16/h11-12H,4-10,16H2,1-3H3 |
| InChIKey | FOKNIOYSADUOGW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |