C14H26FNO3 — CID 115050990
tert-butyl 3-(2-fluoropropyl)-4-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 115050990) has the molecular formula C14H26FNO3 and a molecular weight of 275.36 g/mol. Its IUPAC name is tert-butyl 3-(2-fluoropropyl)-4-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-fluoropropyl)-4-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 115050990 |
| Molecular Formula | C14H26FNO3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | tert-butyl 3-(2-fluoropropyl)-4-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CC(F)CC1CN(C(=O)OC(C)(C)C)CCC1CO |
| InChI | InChI=1S/C14H26FNO3/c1-10(15)7-12-8-16(6-5-11(12)9-17)13(18)19-14(2,3)4/h10-12,17H,5-9H2,1-4H3 |
| InChIKey | XQXSVQPQVFWBJJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |