C14H24FNO2 — CID 146486000
tert-butyl 3-(1-fluoropent-4-enyl)pyrrolidine-1-carboxylate (PubChem CID 146486000) has the molecular formula C14H24FNO2 and a molecular weight of 257.35 g/mol. Its IUPAC name is tert-butyl 3-(1-fluoropent-4-enyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(1-fluoropent-4-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146486000 |
| Molecular Formula | C14H24FNO2 |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | tert-butyl 3-(1-fluoropent-4-enyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCCC(F)C1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H24FNO2/c1-5-6-7-12(15)11-8-9-16(10-11)13(17)18-14(2,3)4/h5,11-12H,1,6-10H2,2-4H3 |
| InChIKey | BPZZUTOUHXXSSP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|