C11H21FN2O3 — CID 115046306
tert-butyl 3-(2-aminooxy-1-fluoroethyl)pyrrolidine-1-carboxylate (PubChem CID 115046306) has the molecular formula C11H21FN2O3 and a molecular weight of 248.30 g/mol. Its IUPAC name is tert-butyl 3-(2-aminooxy-1-fluoroethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2-aminooxy-1-fluoroethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 115046306 |
| Molecular Formula | C11H21FN2O3 |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | tert-butyl 3-(2-aminooxy-1-fluoroethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(F)CON)C1 |
| InChI | InChI=1S/C11H21FN2O3/c1-11(2,3)17-10(15)14-5-4-8(6-14)9(12)7-16-13/h8-9H,4-7,13H2,1-3H3 |
| InChIKey | ILDZCJPMGFMNOV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|