C31H37FN8O3 — CID 11505249
1-[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]-3-[4-[6-(3-morpholin-4-ylpropylamino)pyrimidin-4-yl]oxyphenyl]urea (PubChem CID 11505249) has the molecular formula C31H37FN8O3 and a molecular weight of 588.69 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]-3-[4-[6-(3-morpholin-4-ylpropylamino)pyrimidin-4-yl]oxyphenyl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]-3-[4-[6-(3-morpholin-4-ylpropylamino)pyrimidin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 11505249 |
| Molecular Formula | C31H37FN8O3 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.30 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-fluorophenyl)pyrazol-5-yl]-3-[4-[6-(3-morpholin-4-ylpropylamino)pyrimidin-4-yl]oxyphenyl]urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(Oc3cc(NCCCN4CCOCC4)ncn3)cc2)n(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C31H37FN8O3/c1-31(2,3)26-19-28(40(38-26)24-9-5-22(32)6-10-24)37-30(41)36-23-7-11-25(12-8-23)43-29-20-27(34-21-35-29)33-13-4-14-39-15-17-42-18-16-39/h5-12,19-21H,4,13-18H2,1-3H3,(H,33,34,35)(H2,36,37,41) |
| InChIKey | UUBLDMBYDMCCKE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|