C39H46N8O4 — CID 46235696
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[[2-(4-morpholin-4-ylbutylcarbamoylamino)-4-pyridinyl]oxy]naphthalen-1-yl]urea (PubChem CID 46235696) has the molecular formula C39H46N8O4 and a molecular weight of 690.85 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[[2-(4-morpholin-4-ylbutylcarbamoylamino)-4-pyridinyl]oxy]naphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[[2-(4-morpholin-4-ylbutylcarbamoylamino)-4-pyridinyl]oxy]naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 46235696 |
| Molecular Formula | C39H46N8O4 |
| Molecular Weight | 690.85 g/mol |
| Exact Mass | 690.36 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[[2-(4-morpholin-4-ylbutylcarbamoylamino)-4-pyridinyl]oxy]naphthalen-1-yl]urea |
| SMILES | Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(Oc3ccnc(NC(=O)NCCCCN4CCOCC4)c3)c3ccccc23)cc1 |
| InChI | InChI=1S/C39H46N8O4/c1-27-11-13-28(14-12-27)47-36(26-34(45-47)39(2,3)4)44-38(49)42-32-15-16-33(31-10-6-5-9-30(31)32)51-29-17-19-40-35(25-29)43-37(48)41-18-7-8-20-46-21-23-50-24-22-46/h5-6,9-17,19,25-26H,7-8,18,20-24H2,1-4H3,(H2,42,44,49)(H2,40,41,43,48) |
| InChIKey | WBLLIUWYFWQZHZ-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 134.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.85 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|