C35H37N7O2 — CID 91358531
1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[[2-[(N-cyclopropyl-C-methylcarbonimidoyl)amino]-4-pyridinyl]oxy]naphthalen-1-yl]urea (PubChem CID 91358531) has the molecular formula C35H37N7O2 and a molecular weight of 587.73 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[[2-[(N-cyclopropyl-C-methylcarbonimidoyl)amino]-4-pyridinyl]oxy]naphthalen-1-yl]urea.
| Compound Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[[2-[(N-cyclopropyl-C-methylcarbonimidoyl)amino]-4-pyridinyl]oxy]naphthalen-1-yl]urea |
|---|---|
| PubChem CID | 91358531 |
| Molecular Formula | C35H37N7O2 |
| Molecular Weight | 587.73 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methylphenyl)pyrazol-5-yl]-3-[4-[[2-[(N-cyclopropyl-C-methylcarbonimidoyl)amino]-4-pyridinyl]oxy]naphthalen-1-yl]urea |
| SMILES | C/C(=N\C1CC1)Nc1cc(Oc2ccc(NC(=O)Nc3cc(C(C)(C)C)nn3-c3ccc(C)cc3)c3ccccc23)ccn1 |
| InChI | InChI=1S/C35H37N7O2/c1-22-10-14-25(15-11-22)42-33(21-31(41-42)35(3,4)5)40-34(43)39-29-16-17-30(28-9-7-6-8-27(28)29)44-26-18-19-36-32(20-26)38-23(2)37-24-12-13-24/h6-11,14-21,24H,12-13H2,1-5H3,(H,36,37,38)(H2,39,40,43) |
| InChIKey | PELBFIBZRQBDMQ-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.73 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|