C14H14F3N3O — CID 115053366
2-piperidin-4-yl-9-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 115053366) has the molecular formula C14H14F3N3O and a molecular weight of 297.28 g/mol. Its IUPAC name is 2-piperidin-4-yl-9-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-piperidin-4-yl-9-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115053366 |
| Molecular Formula | C14H14F3N3O |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-piperidin-4-yl-9-(trifluoromethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(C2CCNCC2)nc2c(C(F)(F)F)cccn12 |
| InChI | InChI=1S/C14H14F3N3O/c15-14(16,17)10-2-1-7-20-12(21)8-11(19-13(10)20)9-3-5-18-6-4-9/h1-2,7-9,18H,3-6H2 |
| InChIKey | IIHZNBIZVVJVSZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |