C32H48F2N4O — CID 142511254
2-[(2E,4E)-5-(1,1-difluoroethyl)-6-methylhepta-2,4,6-trien-3-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one;(Z)-3,4-dimethylhex-2-ene;ethane (PubChem CID 142511254) has the molecular formula C32H48F2N4O and a molecular weight of 542.76 g/mol. Its IUPAC name is 2-[(2E,4E)-5-(1,1-difluoroethyl)-6-methylhepta-2,4,6-trien-3-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one;(Z)-3,4-dimethylhex-2-ene;ethane.
| Compound Name | 2-[(2E,4E)-5-(1,1-difluoroethyl)-6-methylhepta-2,4,6-trien-3-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one;(Z)-3,4-dimethylhex-2-ene;ethane |
|---|---|
| PubChem CID | 142511254 |
| Molecular Formula | C32H48F2N4O |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.38 |
| IUPAC Name | 2-[(2E,4E)-5-(1,1-difluoroethyl)-6-methylhepta-2,4,6-trien-3-yl]-7-piperazin-1-ylpyrido[1,2-a]pyrimidin-4-one;(Z)-3,4-dimethylhex-2-ene;ethane |
| SMILES | C/C=C(/C)C(C)CC.C=C(C)/C(=C\C(=C/C)c1cc(=O)n2cc(N3CCNCC3)ccc2n1)C(C)(F)F.CC |
| InChI | InChI=1S/C22H26F2N4O.C8H16.C2H6/c1-5-16(12-18(15(2)3)22(4,23)24)19-13-21(29)28-14-17(6-7-20(28)26-19)27-10-8-25-9-11-27;1-5-7(3)8(4)6-2;1-2/h5-7,12-14,25H,2,8-11H2,1,3-4H3;5,8H,6H2,1-4H3;1-2H3/b16-5+,18-12+;7-5-; |
| InChIKey | NWPUILSXRXYBMH-UJJPYASXSA-N |
| XLogP | 7.69 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|