C22H26FN5O — CID 134558955
7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-[(3E)-4-fluoro-5-prop-1-en-2-yliminopenta-1,3-dien-2-yl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 134558955) has the molecular formula C22H26FN5O and a molecular weight of 395.48 g/mol. Its IUPAC name is 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-[(3E)-4-fluoro-5-prop-1-en-2-yliminopenta-1,3-dien-2-yl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-[(3E)-4-fluoro-5-prop-1-en-2-yliminopenta-1,3-dien-2-yl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 134558955 |
| Molecular Formula | C22H26FN5O |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-2-[(3E)-4-fluoro-5-prop-1-en-2-yliminopenta-1,3-dien-2-yl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C=C(C)/N=C/C(F)=C\C(=C)c1cc(=O)n2cc(N3C[C@@H](C)N[C@@H](C)C3)ccc2n1 |
| InChI | InChI=1S/C22H26FN5O/c1-14(2)24-10-18(23)8-15(3)20-9-22(29)28-13-19(6-7-21(28)26-20)27-11-16(4)25-17(5)12-27/h6-10,13,16-17,25H,1,3,11-12H2,2,4-5H3/b18-8+,24-10+/t16-,17+ |
| InChIKey | YHIPMCWMTBUGEH-UVVSRFGDSA-N |
| XLogP | 3.35 |
| TPSA | 62.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|