C14H16ClN3O — CID 115054752
9-chloro-2-(piperidin-4-ylmethyl)pyrido[1,2-a]pyrimidin-4-one (PubChem CID 115054752) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is 9-chloro-2-(piperidin-4-ylmethyl)pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9-chloro-2-(piperidin-4-ylmethyl)pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 115054752 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 9-chloro-2-(piperidin-4-ylmethyl)pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CC2CCNCC2)nc2c(Cl)cccn12 |
| InChI | InChI=1S/C14H16ClN3O/c15-12-2-1-7-18-13(19)9-11(17-14(12)18)8-10-3-5-16-6-4-10/h1-2,7,9-10,16H,3-6,8H2 |
| InChIKey | TTWVABFNBVKCBP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |