C32H38N4O3 — CID 11505870
5-[[5-[2-(1-adamantyl)ethyl]-2-(2-methylphenyl)-1H-imidazole-4-carbonyl]amino]-2-(dimethylamino)benzoic acid (PubChem CID 11505870) has the molecular formula C32H38N4O3 and a molecular weight of 526.68 g/mol. Its IUPAC name is 5-[[5-[2-(1-adamantyl)ethyl]-2-(2-methylphenyl)-1H-imidazole-4-carbonyl]amino]-2-(dimethylamino)benzoic acid.
| Compound Name | 5-[[5-[2-(1-adamantyl)ethyl]-2-(2-methylphenyl)-1H-imidazole-4-carbonyl]amino]-2-(dimethylamino)benzoic acid |
|---|---|
| PubChem CID | 11505870 |
| Molecular Formula | C32H38N4O3 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | 5-[[5-[2-(1-adamantyl)ethyl]-2-(2-methylphenyl)-1H-imidazole-4-carbonyl]amino]-2-(dimethylamino)benzoic acid |
| SMILES | Cc1ccccc1-c1nc(C(=O)Nc2ccc(N(C)C)c(C(=O)O)c2)c(CCC23CC4CC(CC(C4)C2)C3)[nH]1 |
| InChI | InChI=1S/C32H38N4O3/c1-19-6-4-5-7-24(19)29-34-26(10-11-32-16-20-12-21(17-32)14-22(13-20)18-32)28(35-29)30(37)33-23-8-9-27(36(2)3)25(15-23)31(38)39/h4-9,15,20-22H,10-14,16-18H2,1-3H3,(H,33,37)(H,34,35)(H,38,39) |
| InChIKey | UKVCYRKKYUVFFC-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|