C28H35N3O3 — CID 11518283
3-[[5-[2-(1-adamantyl)ethyl]-2-cyclopentyl-1H-imidazole-4-carbonyl]amino]benzoic acid (PubChem CID 11518283) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 3-[[5-[2-(1-adamantyl)ethyl]-2-cyclopentyl-1H-imidazole-4-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[5-[2-(1-adamantyl)ethyl]-2-cyclopentyl-1H-imidazole-4-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11518283 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 3-[[5-[2-(1-adamantyl)ethyl]-2-cyclopentyl-1H-imidazole-4-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2nc(C3CCCC3)[nH]c2CCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C28H35N3O3/c32-26(29-22-7-3-6-21(13-22)27(33)34)24-23(30-25(31-24)20-4-1-2-5-20)8-9-28-14-17-10-18(15-28)12-19(11-17)16-28/h3,6-7,13,17-20H,1-2,4-5,8-12,14-16H2,(H,29,32)(H,30,31)(H,33,34) |
| InChIKey | SWOWFWBJUIRCIU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |